C18H18N2O3S2 — CID 17393269
3-[[2-[2-(1,3-dithiolan-2-yl)phenoxy]acetyl]amino]benzamide (PubChem CID 17393269) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 3-[[2-[2-(1,3-dithiolan-2-yl)phenoxy]acetyl]amino]benzamide.
| Compound Name | 3-[[2-[2-(1,3-dithiolan-2-yl)phenoxy]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 17393269 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 3-[[2-[2-(1,3-dithiolan-2-yl)phenoxy]acetyl]amino]benzamide |
| SMILES | NC(=O)c1cccc(NC(=O)COc2ccccc2C2SCCS2)c1 |
| InChI | InChI=1S/C18H18N2O3S2/c19-17(22)12-4-3-5-13(10-12)20-16(21)11-23-15-7-2-1-6-14(15)18-24-8-9-25-18/h1-7,10,18H,8-9,11H2,(H2,19,22)(H,20,21) |
| InChIKey | BTZQWXIIVWOWHY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |