C15H20N2O3S2 — CID 9224868
2-[[2-[2-(1,3-dithiolan-2-yl)phenoxy]acetyl]amino]-N-ethylacetamide (PubChem CID 9224868) has the molecular formula C15H20N2O3S2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-[[2-[2-(1,3-dithiolan-2-yl)phenoxy]acetyl]amino]-N-ethylacetamide.
| Compound Name | 2-[[2-[2-(1,3-dithiolan-2-yl)phenoxy]acetyl]amino]-N-ethylacetamide |
|---|---|
| PubChem CID | 9224868 |
| Molecular Formula | C15H20N2O3S2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-[[2-[2-(1,3-dithiolan-2-yl)phenoxy]acetyl]amino]-N-ethylacetamide |
| SMILES | CCNC(=O)CNC(=O)COc1ccccc1C1SCCS1 |
| InChI | InChI=1S/C15H20N2O3S2/c1-2-16-13(18)9-17-14(19)10-20-12-6-4-3-5-11(12)15-21-7-8-22-15/h3-6,15H,2,7-10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | XIFIFWPUUHFDSH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |