C19H19F2NO2S2 — CID 24545612
N-[1-(3,4-difluorophenyl)ethyl]-2-[2-(1,3-dithiolan-2-yl)phenoxy]acetamide (PubChem CID 24545612) has the molecular formula C19H19F2NO2S2 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-2-[2-(1,3-dithiolan-2-yl)phenoxy]acetamide.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-2-[2-(1,3-dithiolan-2-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 24545612 |
| Molecular Formula | C19H19F2NO2S2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-2-[2-(1,3-dithiolan-2-yl)phenoxy]acetamide |
| SMILES | CC(NC(=O)COc1ccccc1C1SCCS1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H19F2NO2S2/c1-12(13-6-7-15(20)16(21)10-13)22-18(23)11-24-17-5-3-2-4-14(17)19-25-8-9-26-19/h2-7,10,12,19H,8-9,11H2,1H3,(H,22,23) |
| InChIKey | RELJFVNLRMNHRF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |