C18H19F2NO3 — CID 8795097
N-[(1R)-1-(3,4-difluorophenyl)ethyl]-2-(2-ethoxyphenoxy)acetamide (PubChem CID 8795097) has the molecular formula C18H19F2NO3 and a molecular weight of 335.35 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-difluorophenyl)ethyl]-2-(2-ethoxyphenoxy)acetamide.
| Compound Name | N-[(1R)-1-(3,4-difluorophenyl)ethyl]-2-(2-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 8795097 |
| Molecular Formula | C18H19F2NO3 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[(1R)-1-(3,4-difluorophenyl)ethyl]-2-(2-ethoxyphenoxy)acetamide |
| SMILES | CCOc1ccccc1OCC(=O)N[C@H](C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H19F2NO3/c1-3-23-16-6-4-5-7-17(16)24-11-18(22)21-12(2)13-8-9-14(19)15(20)10-13/h4-10,12H,3,11H2,1-2H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | ZVXUOVXKLDTOLK-GFCCVEGCSA-N |
| XLogP | 3.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |