C21H26FNO3 — CID 24550111
2-(2-tert-butylphenoxy)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]acetamide (PubChem CID 24550111) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is 2-(2-tert-butylphenoxy)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(2-tert-butylphenoxy)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 24550111 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-(2-tert-butylphenoxy)-N-[1-(3-fluoro-4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(C(C)NC(=O)COc2ccccc2C(C)(C)C)cc1F |
| InChI | InChI=1S/C21H26FNO3/c1-14(15-10-11-19(25-5)17(22)12-15)23-20(24)13-26-18-9-7-6-8-16(18)21(2,3)4/h6-12,14H,13H2,1-5H3,(H,23,24) |
| InChIKey | WDXLDYDWIMSZNR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |