C15H22FNO3 — CID 115949949
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-[(2-methylpropan-2-yl)oxy]acetamide (PubChem CID 115949949) has the molecular formula C15H22FNO3 and a molecular weight of 283.34 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-[(2-methylpropan-2-yl)oxy]acetamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-[(2-methylpropan-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 115949949 |
| Molecular Formula | C15H22FNO3 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-[(2-methylpropan-2-yl)oxy]acetamide |
| SMILES | COc1ccc(C(C)NC(=O)COC(C)(C)C)cc1F |
| InChI | InChI=1S/C15H22FNO3/c1-10(17-14(18)9-20-15(2,3)4)11-6-7-13(19-5)12(16)8-11/h6-8,10H,9H2,1-5H3,(H,17,18) |
| InChIKey | SBODHDOAWWXTEG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |