C18H19F2NO2 — CID 8795085
N-[(1S)-1-(3,4-difluorophenyl)ethyl]-2-(2,5-dimethylphenoxy)acetamide (PubChem CID 8795085) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-difluorophenyl)ethyl]-2-(2,5-dimethylphenoxy)acetamide.
| Compound Name | N-[(1S)-1-(3,4-difluorophenyl)ethyl]-2-(2,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 8795085 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[(1S)-1-(3,4-difluorophenyl)ethyl]-2-(2,5-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)N[C@@H](C)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C18H19F2NO2/c1-11-4-5-12(2)17(8-11)23-10-18(22)21-13(3)14-6-7-15(19)16(20)9-14/h4-9,13H,10H2,1-3H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | ZWHQOLYQJHNKJU-ZDUSSCGKSA-N |
| XLogP | 3.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |