C21H28N2O — CID 109035689
N-(2-tert-butylphenyl)-3-(3,5-dimethylanilino)propanamide (PubChem CID 109035689) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-3-(3,5-dimethylanilino)propanamide.
| Compound Name | N-(2-tert-butylphenyl)-3-(3,5-dimethylanilino)propanamide |
|---|---|
| PubChem CID | 109035689 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | N-(2-tert-butylphenyl)-3-(3,5-dimethylanilino)propanamide |
| SMILES | Cc1cc(C)cc(NCCC(=O)Nc2ccccc2C(C)(C)C)c1 |
| InChI | InChI=1S/C21H28N2O/c1-15-12-16(2)14-17(13-15)22-11-10-20(24)23-19-9-7-6-8-18(19)21(3,4)5/h6-9,12-14,22H,10-11H2,1-5H3,(H,23,24) |
| InChIKey | JTGCHDNJZRXUBC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |