C21H33N3O2 — CID 67567267
N-[[4-[[2-(tert-butylamino)-2-oxoethyl]amino]cyclohexyl]methyl]-3-methylbenzamide (PubChem CID 67567267) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is N-[[4-[[2-(tert-butylamino)-2-oxoethyl]amino]cyclohexyl]methyl]-3-methylbenzamide.
| Compound Name | N-[[4-[[2-(tert-butylamino)-2-oxoethyl]amino]cyclohexyl]methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 67567267 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | N-[[4-[[2-(tert-butylamino)-2-oxoethyl]amino]cyclohexyl]methyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NCC2CCC(NCC(=O)NC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H33N3O2/c1-15-6-5-7-17(12-15)20(26)23-13-16-8-10-18(11-9-16)22-14-19(25)24-21(2,3)4/h5-7,12,16,18,22H,8-11,13-14H2,1-4H3,(H,23,26)(H,24,25) |
| InChIKey | RVUQFQCSKDQLIA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |