[(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate

C15H20O5 — CID 96523723

IUPAC[(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate
SMILESCOc1ccccc1OCC(=O)O[C@@H]1CCC[C@H]1OC
InChIInChI=1S/C15H20O5/c1-17-11-6-3-4-7-13(11)19-10-15(16)20-14-9-5-8-12(14)18-2/h3-4,6-7,12,14H,5,8-10H2,1-2H3/t12-,14-/m1/s1
InChIKeyHSTRKPMYXGEXQG-TZMCWYRMSA-N
MW280.32 g/mol
LogP2.18
Rot. Bonds6

About [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate

[(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate (PubChem CID 96523723) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate.

Molecular Properties

Compound Name[(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate
PubChem CID96523723
Molecular FormulaC15H20O5
Molecular Weight280.32 g/mol
Exact Mass280.13
IUPAC Name[(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate
SMILESCOc1ccccc1OCC(=O)O[C@@H]1CCC[C@H]1OC
InChIInChI=1S/C15H20O5/c1-17-11-6-3-4-7-13(11)19-10-15(16)20-14-9-5-8-12(14)18-2/h3-4,6-7,12,14H,5,8-10H2,1-2H3/t12-,14-/m1/s1
InChIKeyHSTRKPMYXGEXQG-TZMCWYRMSA-N
XLogP2.18
TPSA53.99 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.32
LogP ≤ 52.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate?
The IUPAC name of [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate (CID 96523723) is [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate.
What is the SMILES notation for [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate?
The canonical SMILES for [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate is COc1ccccc1OCC(=O)O[C@@H]1CCC[C@H]1OC.
What is the InChIKey of [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate?
The InChIKey is HSTRKPMYXGEXQG-TZMCWYRMSA-N. The full InChI is InChI=1S/C15H20O5/c1-17-11-6-3-4-7-13(11)19-10-15(16)20-14-9-5-8-12(14)18-2/h3-4,6-7,12,14H,5,8-10H2,1-2H3/t12-,14-/m1/s1.
What are the key properties of [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate?
[(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate has a molecular weight of 280.32 g/mol, XLogP of 2.18, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate is sourced from PubChem (CID 96523723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).