C15H20O5 — CID 96523723
[(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate (PubChem CID 96523723) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 96523723 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | [(1R,2R)-2-methoxycyclopentyl] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)O[C@@H]1CCC[C@H]1OC |
| InChI | InChI=1S/C15H20O5/c1-17-11-6-3-4-7-13(11)19-10-15(16)20-14-9-5-8-12(14)18-2/h3-4,6-7,12,14H,5,8-10H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | HSTRKPMYXGEXQG-TZMCWYRMSA-N |
| XLogP | 2.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |