C14H17FO3 — CID 95622535
[(1S,2R)-2-methoxycyclopentyl] 2-(4-fluorophenyl)acetate (PubChem CID 95622535) has the molecular formula C14H17FO3 and a molecular weight of 252.28 g/mol. Its IUPAC name is [(1S,2R)-2-methoxycyclopentyl] 2-(4-fluorophenyl)acetate.
| Compound Name | [(1S,2R)-2-methoxycyclopentyl] 2-(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 95622535 |
| Molecular Formula | C14H17FO3 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | [(1S,2R)-2-methoxycyclopentyl] 2-(4-fluorophenyl)acetate |
| SMILES | CO[C@@H]1CCC[C@@H]1OC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FO3/c1-17-12-3-2-4-13(12)18-14(16)9-10-5-7-11(15)8-6-10/h5-8,12-13H,2-4,9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | DFQGQQXLWOFOMH-OLZOCXBDSA-N |
| XLogP | 2.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |