C17H24N2O3 — CID 9315686
N-[[(2R,6S)-2,6-dimethylcyclohexylidene]amino]-2-(2-methoxyphenoxy)acetamide (PubChem CID 9315686) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[[(2R,6S)-2,6-dimethylcyclohexylidene]amino]-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-[[(2R,6S)-2,6-dimethylcyclohexylidene]amino]-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 9315686 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[[(2R,6S)-2,6-dimethylcyclohexylidene]amino]-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)N/N=C1/[C@H](C)CCC[C@@H]1C |
| InChI | InChI=1S/C17H24N2O3/c1-12-7-6-8-13(2)17(12)19-18-16(20)11-22-15-10-5-4-9-14(15)21-3/h4-5,9-10,12-13H,6-8,11H2,1-3H3,(H,18,20)/b19-17-/t12-,13+/m1/s1 |
| InChIKey | MCLAQAHZSLBXMB-XRXOUNIRSA-N |
| XLogP | 3.00 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|