C18H26N2O3 — CID 7689241
2-(2-methoxyphenoxy)-N-[(Z)-[(5R)-3,3,5-trimethylcyclohexylidene]amino]acetamide (PubChem CID 7689241) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N-[(Z)-[(5R)-3,3,5-trimethylcyclohexylidene]amino]acetamide.
| Compound Name | 2-(2-methoxyphenoxy)-N-[(Z)-[(5R)-3,3,5-trimethylcyclohexylidene]amino]acetamide |
|---|---|
| PubChem CID | 7689241 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N-[(Z)-[(5R)-3,3,5-trimethylcyclohexylidene]amino]acetamide |
| SMILES | COc1ccccc1OCC(=O)N/N=C1/C[C@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-9-14(11-18(2,3)10-13)19-20-17(21)12-23-16-8-6-5-7-15(16)22-4/h5-8,13H,9-12H2,1-4H3,(H,20,21)/b19-14-/t13-/m0/s1 |
| InChIKey | NJWJLDALIHWMQI-ISNHLSKGSA-N |
| XLogP | 3.39 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|