C18H26N2O3 — CID 2388249
2-(2-methoxyphenoxy)-N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]acetohydrazide (PubChem CID 2388249) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]acetohydrazide.
| Compound Name | 2-(2-methoxyphenoxy)-N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]acetohydrazide |
|---|---|
| PubChem CID | 2388249 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-(2-methoxyphenoxy)-N'-[(5R)-3,3,5-trimethylcyclohexen-1-yl]acetohydrazide |
| SMILES | COc1ccccc1OCC(=O)NNC1=CC(C)(C)C[C@@H](C)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-9-14(11-18(2,3)10-13)19-20-17(21)12-23-16-8-6-5-7-15(16)22-4/h5-8,11,13,19H,9-10,12H2,1-4H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | HWLTZIZHZPKVIM-ZDUSSCGKSA-N |
| XLogP | 3.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|