C18H23N3O2 — CID 9316535
2-(4-cyanophenoxy)-N-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]acetamide (PubChem CID 9316535) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]acetamide |
|---|---|
| PubChem CID | 9316535 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[(Z)-[(5S)-3,3,5-trimethylcyclohexylidene]amino]acetamide |
| SMILES | C[C@@H]1C/C(=N/NC(=O)COc2ccc(C#N)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C18H23N3O2/c1-13-8-15(10-18(2,3)9-13)20-21-17(22)12-23-16-6-4-14(11-19)5-7-16/h4-7,13H,8-10,12H2,1-3H3,(H,21,22)/b20-15-/t13-/m1/s1 |
| InChIKey | VPBLNCZQCAKTBX-LKCUONQHSA-N |
| XLogP | 3.26 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|