C14H18F9NO2 — CID 170252631
2-piperidin-4-ylpropan-2-yl 3,3,4,4,5,5,6,6,6-nonafluorohexanoate (PubChem CID 170252631) has the molecular formula C14H18F9NO2 and a molecular weight of 403.29 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 3,3,4,4,5,5,6,6,6-nonafluorohexanoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 3,3,4,4,5,5,6,6,6-nonafluorohexanoate |
|---|---|
| PubChem CID | 170252631 |
| Molecular Formula | C14H18F9NO2 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 3,3,4,4,5,5,6,6,6-nonafluorohexanoate |
| SMILES | CC(C)(OC(=O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1CCNCC1 |
| InChI | InChI=1S/C14H18F9NO2/c1-10(2,8-3-5-24-6-4-8)26-9(25)7-11(15,16)12(17,18)13(19,20)14(21,22)23/h8,24H,3-7H2,1-2H3 |
| InChIKey | IWZOHRSUVZSCHO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|