C11H18Br3NO2 — CID 162509085
2-(3-methylpiperidin-4-yl)propan-2-yl 2,2,2-tribromoacetate (PubChem CID 162509085) has the molecular formula C11H18Br3NO2 and a molecular weight of 435.98 g/mol. Its IUPAC name is 2-(3-methylpiperidin-4-yl)propan-2-yl 2,2,2-tribromoacetate.
| Compound Name | 2-(3-methylpiperidin-4-yl)propan-2-yl 2,2,2-tribromoacetate |
|---|---|
| PubChem CID | 162509085 |
| Molecular Formula | C11H18Br3NO2 |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 432.89 |
| IUPAC Name | 2-(3-methylpiperidin-4-yl)propan-2-yl 2,2,2-tribromoacetate |
| SMILES | CC1CNCCC1C(C)(C)OC(=O)C(Br)(Br)Br |
| InChI | InChI=1S/C11H18Br3NO2/c1-7-6-15-5-4-8(7)10(2,3)17-9(16)11(12,13)14/h7-8,15H,4-6H2,1-3H3 |
| InChIKey | KYFWSDXCECSDKC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|