C8H13NO4 — CID 146281507
methyl 7-amino-2,7-dioxoheptanoate (PubChem CID 146281507) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is methyl 7-amino-2,7-dioxoheptanoate.
| Compound Name | methyl 7-amino-2,7-dioxoheptanoate |
|---|---|
| PubChem CID | 146281507 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | methyl 7-amino-2,7-dioxoheptanoate |
| SMILES | COC(=O)C(=O)CCCCC(N)=O |
| InChI | InChI=1S/C8H13NO4/c1-13-8(12)6(10)4-2-3-5-7(9)11/h2-5H2,1H3,(H2,9,11) |
| InChIKey | RXVYUZBTFDNLAR-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|