C9H16N2O5S — CID 146281530
methyl 8-[amino(sulfanyloxy)amino]-2,8-dioxooctanoate (PubChem CID 146281530) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is methyl 8-[amino(sulfanyloxy)amino]-2,8-dioxooctanoate.
| Compound Name | methyl 8-[amino(sulfanyloxy)amino]-2,8-dioxooctanoate |
|---|---|
| PubChem CID | 146281530 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | methyl 8-[amino(sulfanyloxy)amino]-2,8-dioxooctanoate |
| SMILES | COC(=O)C(=O)CCCCCC(=O)N(N)OS |
| InChI | InChI=1S/C9H16N2O5S/c1-15-9(14)7(12)5-3-2-4-6-8(13)11(10)16-17/h17H,2-6,10H2,1H3 |
| InChIKey | MZBYZGIYIIZHMN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|