C17H28BNO10 — CID 165013000
deuterio(imino)borane;8-methoxy-7,8-dioxooctanoic acid;2-oxooctanedioic acid (PubChem CID 165013000) has the molecular formula C17H28BNO10 and a molecular weight of 418.23 g/mol. Its IUPAC name is deuterio(imino)borane;8-methoxy-7,8-dioxooctanoic acid;2-oxooctanedioic acid.
| Compound Name | deuterio(imino)borane;8-methoxy-7,8-dioxooctanoic acid;2-oxooctanedioic acid |
|---|---|
| PubChem CID | 165013000 |
| Molecular Formula | C17H28BNO10 |
| Molecular Weight | 418.23 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | deuterio(imino)borane;8-methoxy-7,8-dioxooctanoic acid;2-oxooctanedioic acid |
| SMILES | COC(=O)C(=O)CCCCCC(=O)O.O=C(O)CCCCCC(=O)C(=O)O.[H]/N=B/[2H] |
| InChI | InChI=1S/C9H14O5.C8H12O5.BH2N/c1-14-9(13)7(10)5-3-2-4-6-8(11)12;9-6(8(12)13)4-2-1-3-5-7(10)11;1-2/h2-6H2,1H3,(H,11,12);1-5H2,(H,10,11)(H,12,13);1-2H/i;;1D |
| InChIKey | JZGBDILPEHCTOL-PRQZKWGPSA-N |
| XLogP | 1.09 |
| TPSA | 196.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.23 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|