About butanamide;dichlorozirconium
butanamide;dichlorozirconium (PubChem CID 175565621) has the molecular formula C4H9Cl2NOZr
and a molecular weight of 249.25 g/mol. Its IUPAC name is butanamide;dichlorozirconium.
Molecular Properties
| Compound Name | butanamide;dichlorozirconium |
| PubChem CID | 175565621 |
| Molecular Formula | C4H9Cl2NOZr |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 246.91 |
| IUPAC Name | butanamide;dichlorozirconium |
| SMILES | CCCC(N)=O.Cl[Zr]Cl |
| InChI | InChI=1S/C4H9NO.2ClH.Zr/c1-2-3-4(5)6;;;/h2-3H2,1H3,(H2,5,6);2*1H;/q;;;+2/p-2 |
| InChIKey | HQPVLZKLOWDGQY-UHFFFAOYSA-L |
| XLogP | 1.65 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butanamide;dichlorozirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide;dichlorozirconium?
The IUPAC name of butanamide;dichlorozirconium (CID 175565621) is butanamide;dichlorozirconium.
What is the SMILES notation for butanamide;dichlorozirconium?
The canonical SMILES for butanamide;dichlorozirconium is CCCC(N)=O.Cl[Zr]Cl.
What is the InChIKey of butanamide;dichlorozirconium?
The InChIKey is HQPVLZKLOWDGQY-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H9NO.2ClH.Zr/c1-2-3-4(5)6;;;/h2-3H2,1H3,(H2,5,6);2*1H;/q;;;+2/p-2.
What are the key properties of butanamide;dichlorozirconium?
butanamide;dichlorozirconium has a molecular weight of 249.25 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide;dichlorozirconium is sourced from PubChem (CID 175565621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).