C20H20N4O5 — CID 10000807
4-[(2E)-2-[1-[(4-carboxyphenyl)diazenyl]-4-methyl-2-oxopentylidene]hydrazinyl]benzoic acid (PubChem CID 10000807) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is 4-[(2E)-2-[1-[(4-carboxyphenyl)diazenyl]-4-methyl-2-oxopentylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[(2E)-2-[1-[(4-carboxyphenyl)diazenyl]-4-methyl-2-oxopentylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 10000807 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-[(2E)-2-[1-[(4-carboxyphenyl)diazenyl]-4-methyl-2-oxopentylidene]hydrazinyl]benzoic acid |
| SMILES | CC(C)CC(=O)C(/N=N/c1ccc(C(=O)O)cc1)=N\Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H20N4O5/c1-12(2)11-17(25)18(23-21-15-7-3-13(4-8-15)19(26)27)24-22-16-9-5-14(6-10-16)20(28)29/h3-10,12,21H,11H2,1-2H3,(H,26,27)(H,28,29)/b23-18+,24-22+ |
| InChIKey | WGTFPVOXOGBAMU-MAMLLYSWSA-N |
| XLogP | 4.21 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|