C25H46N4 — CID 10001192
2-[(4R)-4-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]guanidine (PubChem CID 10001192) has the molecular formula C25H46N4 and a molecular weight of 402.67 g/mol. Its IUPAC name is 2-[(4R)-4-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]guanidine.
| Compound Name | 2-[(4R)-4-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]guanidine |
|---|---|
| PubChem CID | 10001192 |
| Molecular Formula | C25H46N4 |
| Molecular Weight | 402.67 g/mol |
| Exact Mass | 402.37 |
| IUPAC Name | 2-[(4R)-4-[(3S,5R,8R,9S,10S,13R,14S,17R)-3-amino-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentyl]guanidine |
| SMILES | C[C@H](CCCN=C(N)N)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@H](N)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H46N4/c1-16(5-4-14-29-23(27)28)20-8-9-21-19-7-6-17-15-18(26)10-12-24(17,2)22(19)11-13-25(20,21)3/h16-22H,4-15,26H2,1-3H3,(H4,27,28,29)/t16-,17-,18+,19+,20-,21+,22+,24+,25-/m1/s1 |
| InChIKey | JYVVAAOYOXNPTL-ARCWCCGYSA-N |
| XLogP | 4.66 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|