C17H22F3N3O5 — CID 10001324
1-[4-(trifluoromethyl)phenyl]-3-[[(2R,3R,4R,5R)-3,4,5-trihydroxy-6-oxo-1-propylpiperidin-2-yl]methyl]urea (PubChem CID 10001324) has the molecular formula C17H22F3N3O5 and a molecular weight of 405.37 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]-3-[[(2R,3R,4R,5R)-3,4,5-trihydroxy-6-oxo-1-propylpiperidin-2-yl]methyl]urea.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]-3-[[(2R,3R,4R,5R)-3,4,5-trihydroxy-6-oxo-1-propylpiperidin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 10001324 |
| Molecular Formula | C17H22F3N3O5 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]-3-[[(2R,3R,4R,5R)-3,4,5-trihydroxy-6-oxo-1-propylpiperidin-2-yl]methyl]urea |
| SMILES | CCCN1C(=O)[C@H](O)[C@H](O)[C@H](O)[C@H]1CNC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H22F3N3O5/c1-2-7-23-11(12(24)13(25)14(26)15(23)27)8-21-16(28)22-10-5-3-9(4-6-10)17(18,19)20/h3-6,11-14,24-26H,2,7-8H2,1H3,(H2,21,22,28)/t11-,12-,13-,14-/m1/s1 |
| InChIKey | KPBOQNFGZYAGTR-AAVRWANBSA-N |
| XLogP | 0.53 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |