C14H12F3N3O4 — CID 70595319
1,3-dimethyl-2,4,6-trioxo-N-[4-(trifluoromethyl)phenyl]-1,3-diazinane-5-carboxamide (PubChem CID 70595319) has the molecular formula C14H12F3N3O4 and a molecular weight of 343.26 g/mol. Its IUPAC name is 1,3-dimethyl-2,4,6-trioxo-N-[4-(trifluoromethyl)phenyl]-1,3-diazinane-5-carboxamide.
| Compound Name | 1,3-dimethyl-2,4,6-trioxo-N-[4-(trifluoromethyl)phenyl]-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 70595319 |
| Molecular Formula | C14H12F3N3O4 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 1,3-dimethyl-2,4,6-trioxo-N-[4-(trifluoromethyl)phenyl]-1,3-diazinane-5-carboxamide |
| SMILES | CN1C(=O)C(C(=O)Nc2ccc(C(F)(F)F)cc2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C14H12F3N3O4/c1-19-11(22)9(12(23)20(2)13(19)24)10(21)18-8-5-3-7(4-6-8)14(15,16)17/h3-6,9H,1-2H3,(H,18,21) |
| InChIKey | BRNNYZUVGZGERL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|