C17H12F4N2O2S — CID 56629241
7-fluoro-4-methyl-3-oxo-N-[4-(trifluoromethyl)phenyl]-1,4-benzothiazine-2-carboxamide (PubChem CID 56629241) has the molecular formula C17H12F4N2O2S and a molecular weight of 384.35 g/mol. Its IUPAC name is 7-fluoro-4-methyl-3-oxo-N-[4-(trifluoromethyl)phenyl]-1,4-benzothiazine-2-carboxamide.
| Compound Name | 7-fluoro-4-methyl-3-oxo-N-[4-(trifluoromethyl)phenyl]-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 56629241 |
| Molecular Formula | C17H12F4N2O2S |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 7-fluoro-4-methyl-3-oxo-N-[4-(trifluoromethyl)phenyl]-1,4-benzothiazine-2-carboxamide |
| SMILES | CN1C(=O)C(C(=O)Nc2ccc(C(F)(F)F)cc2)Sc2cc(F)ccc21 |
| InChI | InChI=1S/C17H12F4N2O2S/c1-23-12-7-4-10(18)8-13(12)26-14(16(23)25)15(24)22-11-5-2-9(3-6-11)17(19,20)21/h2-8,14H,1H3,(H,22,24) |
| InChIKey | YFVQTILRBIUNLU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|