C22H21ClN4O2 — CID 10001523
3-(2-chlorophenyl)-4-[1-[3-(dimethylamino)propyl]pyrrolo[2,3-b]pyridin-3-yl]pyrrole-2,5-dione (PubChem CID 10001523) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4-[1-[3-(dimethylamino)propyl]pyrrolo[2,3-b]pyridin-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-(2-chlorophenyl)-4-[1-[3-(dimethylamino)propyl]pyrrolo[2,3-b]pyridin-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 10001523 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-(2-chlorophenyl)-4-[1-[3-(dimethylamino)propyl]pyrrolo[2,3-b]pyridin-3-yl]pyrrole-2,5-dione |
| SMILES | CN(C)CCCn1cc(C2=C(c3ccccc3Cl)C(=O)NC2=O)c2cccnc21 |
| InChI | InChI=1S/C22H21ClN4O2/c1-26(2)11-6-12-27-13-16(14-8-5-10-24-20(14)27)19-18(21(28)25-22(19)29)15-7-3-4-9-17(15)23/h3-5,7-10,13H,6,11-12H2,1-2H3,(H,25,28,29) |
| InChIKey | PFGKNOJIVKFCCZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|