C15H10F4N6O3 — CID 1000185
2-(4-nitropyrazol-1-yl)-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]acetamide (PubChem CID 1000185) has the molecular formula C15H10F4N6O3 and a molecular weight of 398.28 g/mol. Its IUPAC name is 2-(4-nitropyrazol-1-yl)-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]acetamide.
| Compound Name | 2-(4-nitropyrazol-1-yl)-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]acetamide |
|---|---|
| PubChem CID | 1000185 |
| Molecular Formula | C15H10F4N6O3 |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-(4-nitropyrazol-1-yl)-N-[1-[(2,3,5,6-tetrafluorophenyl)methyl]pyrazol-3-yl]acetamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)Nc1ccn(Cc2c(F)c(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C15H10F4N6O3/c16-10-3-11(17)15(19)9(14(10)18)6-23-2-1-12(22-23)21-13(26)7-24-5-8(4-20-24)25(27)28/h1-5H,6-7H2,(H,21,22,26) |
| InChIKey | MMKIHSISIJISQF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|