C16H15FN6O3 — CID 998871
N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide (PubChem CID 998871) has the molecular formula C16H15FN6O3 and a molecular weight of 358.33 g/mol. Its IUPAC name is N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 998871 |
| Molecular Formula | C16H15FN6O3 |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[1-[(2-fluorophenyl)methyl]pyrazol-3-yl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)Nc2ccn(Cc3ccccc3F)n2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15FN6O3/c1-10-14(23(25)26)15(21(2)19-10)16(24)18-13-7-8-22(20-13)9-11-5-3-4-6-12(11)17/h3-8H,9H2,1-2H3,(H,18,20,24) |
| InChIKey | OZHXMMWFUHRLEK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|