C21H36O6S — CID 10001984
[(1S)-1-[(3R,5R,8R,9S,10S,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl] hydrogen sulfate (PubChem CID 10001984) has the molecular formula C21H36O6S and a molecular weight of 416.58 g/mol. Its IUPAC name is [(1S)-1-[(3R,5R,8R,9S,10S,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl] hydrogen sulfate.
| Compound Name | [(1S)-1-[(3R,5R,8R,9S,10S,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl] hydrogen sulfate |
|---|---|
| PubChem CID | 10001984 |
| Molecular Formula | C21H36O6S |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | [(1S)-1-[(3R,5R,8R,9S,10S,13S,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethyl] hydrogen sulfate |
| SMILES | C[C@H](OS(=O)(=O)O)[C@@]1(O)CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C21H36O6S/c1-13(27-28(24,25)26)21(23)11-8-18-16-5-4-14-12-15(22)6-9-19(14,2)17(16)7-10-20(18,21)3/h13-18,22-23H,4-12H2,1-3H3,(H,24,25,26)/t13-,14+,15+,16+,17-,18-,19-,20-,21-/m0/s1 |
| InChIKey | PJXCBDWVEYGLDL-UHHUKTEYSA-N |
| XLogP | 3.33 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|