C25H30N2O4 — CID 10002359
3-methoxy-4-[[1-methyl-5-(2-methylpentylcarbamoyl)indol-3-yl]methyl]benzoic acid (PubChem CID 10002359) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 3-methoxy-4-[[1-methyl-5-(2-methylpentylcarbamoyl)indol-3-yl]methyl]benzoic acid.
| Compound Name | 3-methoxy-4-[[1-methyl-5-(2-methylpentylcarbamoyl)indol-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 10002359 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 3-methoxy-4-[[1-methyl-5-(2-methylpentylcarbamoyl)indol-3-yl]methyl]benzoic acid |
| SMILES | CCCC(C)CNC(=O)c1ccc2c(c1)c(Cc1ccc(C(=O)O)cc1OC)cn2C |
| InChI | InChI=1S/C25H30N2O4/c1-5-6-16(2)14-26-24(28)18-9-10-22-21(12-18)20(15-27(22)3)11-17-7-8-19(25(29)30)13-23(17)31-4/h7-10,12-13,15-16H,5-6,11,14H2,1-4H3,(H,26,28)(H,29,30) |
| InChIKey | VBWWKLMFUUXKEU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |