C29H38N2O4 — CID 10412800
methyl 3-methoxy-4-[[1-methyl-5-(2-methyloctylcarbamoyl)indol-3-yl]methyl]benzoate (PubChem CID 10412800) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is methyl 3-methoxy-4-[[1-methyl-5-(2-methyloctylcarbamoyl)indol-3-yl]methyl]benzoate.
| Compound Name | methyl 3-methoxy-4-[[1-methyl-5-(2-methyloctylcarbamoyl)indol-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 10412800 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | methyl 3-methoxy-4-[[1-methyl-5-(2-methyloctylcarbamoyl)indol-3-yl]methyl]benzoate |
| SMILES | CCCCCCC(C)CNC(=O)c1ccc2c(c1)c(Cc1ccc(C(=O)OC)cc1OC)cn2C |
| InChI | InChI=1S/C29H38N2O4/c1-6-7-8-9-10-20(2)18-30-28(32)22-13-14-26-25(16-22)24(19-31(26)3)15-21-11-12-23(29(33)35-5)17-27(21)34-4/h11-14,16-17,19-20H,6-10,15,18H2,1-5H3,(H,30,32) |
| InChIKey | HCYCBAUIVZBFDK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|