C28H36N2O4 — CID 14882666
methyl 3-methoxy-4-[[5-[4-oxo-4-(propylamino)butyl]-1-propylindol-3-yl]methyl]benzoate (PubChem CID 14882666) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is methyl 3-methoxy-4-[[5-[4-oxo-4-(propylamino)butyl]-1-propylindol-3-yl]methyl]benzoate.
| Compound Name | methyl 3-methoxy-4-[[5-[4-oxo-4-(propylamino)butyl]-1-propylindol-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 14882666 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | methyl 3-methoxy-4-[[5-[4-oxo-4-(propylamino)butyl]-1-propylindol-3-yl]methyl]benzoate |
| SMILES | CCCNC(=O)CCCc1ccc2c(c1)c(Cc1ccc(C(=O)OC)cc1OC)cn2CCC |
| InChI | InChI=1S/C28H36N2O4/c1-5-14-29-27(31)9-7-8-20-10-13-25-24(16-20)23(19-30(25)15-6-2)17-21-11-12-22(28(32)34-4)18-26(21)33-3/h10-13,16,18-19H,5-9,14-15,17H2,1-4H3,(H,29,31) |
| InChIKey | XRIRIVFXVJCBNC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |