C22H24N2O3 — CID 23365878
methyl 4-[[5-amino-1-(cyclopropylmethyl)indol-3-yl]methyl]-3-methoxybenzoate (PubChem CID 23365878) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is methyl 4-[[5-amino-1-(cyclopropylmethyl)indol-3-yl]methyl]-3-methoxybenzoate.
| Compound Name | methyl 4-[[5-amino-1-(cyclopropylmethyl)indol-3-yl]methyl]-3-methoxybenzoate |
|---|---|
| PubChem CID | 23365878 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | methyl 4-[[5-amino-1-(cyclopropylmethyl)indol-3-yl]methyl]-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(Cc2cn(CC3CC3)c3ccc(N)cc23)c(OC)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-26-21-10-16(22(25)27-2)6-5-15(21)9-17-13-24(12-14-3-4-14)20-8-7-18(23)11-19(17)20/h5-8,10-11,13-14H,3-4,9,12,23H2,1-2H3 |
| InChIKey | LBPAHOABHCETRG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|