C26H23N3O5 — CID 19010474
methyl 3-methoxy-4-[[5-nitro-1-[(E)-3-pyridin-2-ylprop-2-enyl]indol-3-yl]methyl]benzoate (PubChem CID 19010474) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is methyl 3-methoxy-4-[[5-nitro-1-[(E)-3-pyridin-2-ylprop-2-enyl]indol-3-yl]methyl]benzoate.
| Compound Name | methyl 3-methoxy-4-[[5-nitro-1-[(E)-3-pyridin-2-ylprop-2-enyl]indol-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19010474 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | methyl 3-methoxy-4-[[5-nitro-1-[(E)-3-pyridin-2-ylprop-2-enyl]indol-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cc2cn(C/C=C/c3ccccn3)c3ccc([N+](=O)[O-])cc23)c(OC)c1 |
| InChI | InChI=1S/C26H23N3O5/c1-33-25-15-19(26(30)34-2)9-8-18(25)14-20-17-28(13-5-7-21-6-3-4-12-27-21)24-11-10-22(29(31)32)16-23(20)24/h3-12,15-17H,13-14H2,1-2H3/b7-5+ |
| InChIKey | ATHIIEZHJHNVID-FNORWQNLSA-N |
| XLogP | 5.04 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|