C30H25N3O5 — CID 19010483
methyl 3-methoxy-4-[[5-nitro-1-[(E)-3-quinolin-2-ylprop-2-enyl]indol-3-yl]methyl]benzoate (PubChem CID 19010483) has the molecular formula C30H25N3O5 and a molecular weight of 507.55 g/mol. Its IUPAC name is methyl 3-methoxy-4-[[5-nitro-1-[(E)-3-quinolin-2-ylprop-2-enyl]indol-3-yl]methyl]benzoate.
| Compound Name | methyl 3-methoxy-4-[[5-nitro-1-[(E)-3-quinolin-2-ylprop-2-enyl]indol-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 19010483 |
| Molecular Formula | C30H25N3O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | methyl 3-methoxy-4-[[5-nitro-1-[(E)-3-quinolin-2-ylprop-2-enyl]indol-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cc2cn(C/C=C/c3ccc4ccccc4n3)c3ccc([N+](=O)[O-])cc23)c(OC)c1 |
| InChI | InChI=1S/C30H25N3O5/c1-37-29-17-22(30(34)38-2)10-9-21(29)16-23-19-32(28-14-13-25(33(35)36)18-26(23)28)15-5-7-24-12-11-20-6-3-4-8-27(20)31-24/h3-14,17-19H,15-16H2,1-2H3/b7-5+ |
| InChIKey | YHWWVLAJOCYJEP-FNORWQNLSA-N |
| XLogP | 6.20 |
| TPSA | 96.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|