C20H17ClN4O3S — CID 10002705
N-[(6R,7R)-3-(2-chlorophenyl)-7-(4-methoxyphenyl)-5-oxo-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3]thiazin-6-yl]acetamide (PubChem CID 10002705) has the molecular formula C20H17ClN4O3S and a molecular weight of 428.90 g/mol. Its IUPAC name is N-[(6R,7R)-3-(2-chlorophenyl)-7-(4-methoxyphenyl)-5-oxo-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3]thiazin-6-yl]acetamide.
| Compound Name | N-[(6R,7R)-3-(2-chlorophenyl)-7-(4-methoxyphenyl)-5-oxo-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3]thiazin-6-yl]acetamide |
|---|---|
| PubChem CID | 10002705 |
| Molecular Formula | C20H17ClN4O3S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | N-[(6R,7R)-3-(2-chlorophenyl)-7-(4-methoxyphenyl)-5-oxo-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3]thiazin-6-yl]acetamide |
| SMILES | COc1ccc([C@H]2Sc3nnc(-c4ccccc4Cl)n3C(=O)[C@H]2NC(C)=O)cc1 |
| InChI | InChI=1S/C20H17ClN4O3S/c1-11(26)22-16-17(12-7-9-13(28-2)10-8-12)29-20-24-23-18(25(20)19(16)27)14-5-3-4-6-15(14)21/h3-10,16-17H,1-2H3,(H,22,26)/t16-,17+/m0/s1 |
| InChIKey | JGIIXLKJSRVCFF-DLBZAZTESA-N |
| XLogP | 3.60 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |