C24H19ClN2O3S2 — CID 10624666
N-[(5R,6R)-6-(4-chlorophenyl)-3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazinan-5-yl]benzamide (PubChem CID 10624666) has the molecular formula C24H19ClN2O3S2 and a molecular weight of 483.01 g/mol. Its IUPAC name is N-[(5R,6R)-6-(4-chlorophenyl)-3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazinan-5-yl]benzamide.
| Compound Name | N-[(5R,6R)-6-(4-chlorophenyl)-3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazinan-5-yl]benzamide |
|---|---|
| PubChem CID | 10624666 |
| Molecular Formula | C24H19ClN2O3S2 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | N-[(5R,6R)-6-(4-chlorophenyl)-3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazinan-5-yl]benzamide |
| SMILES | COc1ccc(N2C(=O)[C@@H](NC(=O)c3ccccc3)[C@@H](c3ccc(Cl)cc3)SC2=S)cc1 |
| InChI | InChI=1S/C24H19ClN2O3S2/c1-30-19-13-11-18(12-14-19)27-23(29)20(26-22(28)16-5-3-2-4-6-16)21(32-24(27)31)15-7-9-17(25)10-8-15/h2-14,20-21H,1H3,(H,26,28)/t20-,21+/m0/s1 |
| InChIKey | LJWSVOXVIVCPLB-LEWJYISDSA-N |
| XLogP | 5.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|