C20H16N2O4S4 — CID 4762463
3-(4-methoxyphenyl)-5-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4762463) has the molecular formula C20H16N2O4S4 and a molecular weight of 476.63 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-5-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-methoxyphenyl)-5-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4762463 |
| Molecular Formula | C20H16N2O4S4 |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | 3-(4-methoxyphenyl)-5-[3-(4-methoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)C(C3SC(=S)N(c4ccc(OC)cc4)C3=O)SC2=S)cc1 |
| InChI | InChI=1S/C20H16N2O4S4/c1-25-13-7-3-11(4-8-13)21-17(23)15(29-19(21)27)16-18(24)22(20(28)30-16)12-5-9-14(26-2)10-6-12/h3-10,15-16H,1-2H3 |
| InChIKey | MXWDLZYSBSYEHY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|