C26H20N2O3S3 — CID 57363333
5-[5-[(4-methoxyphenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-yl]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 57363333) has the molecular formula C26H20N2O3S3 and a molecular weight of 504.66 g/mol. Its IUPAC name is 5-[5-[(4-methoxyphenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-yl]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[5-[(4-methoxyphenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-yl]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 57363333 |
| Molecular Formula | C26H20N2O3S3 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 5-[5-[(4-methoxyphenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-yl]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=C2SC(C3SC(=S)N(c4ccccc4)C3=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H20N2O3S3/c1-31-20-14-12-17(13-15-20)16-21-23(29)27(18-8-4-2-5-9-18)25(33-21)22-24(30)28(26(32)34-22)19-10-6-3-7-11-19/h2-16,22,25H,1H3 |
| InChIKey | UVTUICBSXPDMBO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|