C24H20ClNO2S — CID 40871906
(2S,5E)-5-[(4-chlorophenyl)methylidene]-3-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-thiazolidin-4-one (PubChem CID 40871906) has the molecular formula C24H20ClNO2S and a molecular weight of 421.95 g/mol. Its IUPAC name is (2S,5E)-5-[(4-chlorophenyl)methylidene]-3-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2S,5E)-5-[(4-chlorophenyl)methylidene]-3-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 40871906 |
| Molecular Formula | C24H20ClNO2S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | (2S,5E)-5-[(4-chlorophenyl)methylidene]-3-(4-methoxyphenyl)-2-(4-methylphenyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)/C(=C\c3ccc(Cl)cc3)S[C@H]2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H20ClNO2S/c1-16-3-7-18(8-4-16)24-26(20-11-13-21(28-2)14-12-20)23(27)22(29-24)15-17-5-9-19(25)10-6-17/h3-15,24H,1-2H3/b22-15+/t24-/m0/s1 |
| InChIKey | POOBMHPTQIRAMJ-NLZIUFDSSA-N |
| XLogP | 6.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|