C23H17Cl2NOS — CID 40850940
(2R,5E)-2-(4-chlorophenyl)-5-[(4-chlorophenyl)methylidene]-3-(4-methylphenyl)-1,3-thiazolidin-4-one (PubChem CID 40850940) has the molecular formula C23H17Cl2NOS and a molecular weight of 426.37 g/mol. Its IUPAC name is (2R,5E)-2-(4-chlorophenyl)-5-[(4-chlorophenyl)methylidene]-3-(4-methylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | (2R,5E)-2-(4-chlorophenyl)-5-[(4-chlorophenyl)methylidene]-3-(4-methylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 40850940 |
| Molecular Formula | C23H17Cl2NOS |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | (2R,5E)-2-(4-chlorophenyl)-5-[(4-chlorophenyl)methylidene]-3-(4-methylphenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(N2C(=O)/C(=C\c3ccc(Cl)cc3)S[C@@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H17Cl2NOS/c1-15-2-12-20(13-3-15)26-22(27)21(14-16-4-8-18(24)9-5-16)28-23(26)17-6-10-19(25)11-7-17/h2-14,23H,1H3/b21-14+/t23-/m1/s1 |
| InChIKey | PHKZAQZUAVDEGJ-XOYGFPHKSA-N |
| XLogP | 7.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|