C28H20ClNO2S — CID 5470253
(5E)-3-(4-chlorophenyl)-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 5470253) has the molecular formula C28H20ClNO2S and a molecular weight of 469.99 g/mol. Its IUPAC name is (5E)-3-(4-chlorophenyl)-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(4-chlorophenyl)-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5470253 |
| Molecular Formula | C28H20ClNO2S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (5E)-3-(4-chlorophenyl)-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cccc(Oc3ccccc3)c2)SC(c2ccccc2)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H20ClNO2S/c29-22-14-16-23(17-15-22)30-27(31)26(33-28(30)21-9-3-1-4-10-21)19-20-8-7-13-25(18-20)32-24-11-5-2-6-12-24/h1-19,28H/b26-19+ |
| InChIKey | FNCQMTQAJVNPLQ-LGUFXXKBSA-N |
| XLogP | 7.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|