C28H20ClNO4S — CID 5470273
(5E)-3-(3-chlorophenyl)-1,1-dioxo-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 5470273) has the molecular formula C28H20ClNO4S and a molecular weight of 501.99 g/mol. Its IUPAC name is (5E)-3-(3-chlorophenyl)-1,1-dioxo-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(3-chlorophenyl)-1,1-dioxo-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5470273 |
| Molecular Formula | C28H20ClNO4S |
| Molecular Weight | 501.99 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | (5E)-3-(3-chlorophenyl)-1,1-dioxo-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cccc(Oc3ccccc3)c2)S(=O)(=O)C(c2ccccc2)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H20ClNO4S/c29-22-12-8-13-23(19-22)30-27(31)26(35(32,33)28(30)21-10-3-1-4-11-21)18-20-9-7-16-25(17-20)34-24-14-5-2-6-15-24/h1-19,28H/b26-18+ |
| InChIKey | ZJQDOCYIHFPWRR-NLRVBDNBSA-N |
| XLogP | 6.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.99 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|