C21H15ClN2O3 — CID 69095941
(5S)-1-[3-(4-chlorophenoxy)phenyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 69095941) has the molecular formula C21H15ClN2O3 and a molecular weight of 378.82 g/mol. Its IUPAC name is (5S)-1-[3-(4-chlorophenoxy)phenyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-1-[3-(4-chlorophenoxy)phenyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 69095941 |
| Molecular Formula | C21H15ClN2O3 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (5S)-1-[3-(4-chlorophenoxy)phenyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)N(c2cccc(Oc3ccc(Cl)cc3)c2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H15ClN2O3/c22-15-9-11-17(12-10-15)27-18-8-4-7-16(13-18)24-19(20(25)23-21(24)26)14-5-2-1-3-6-14/h1-13,19H,(H,23,25,26)/t19-/m0/s1 |
| InChIKey | DHJYOHCOQIDRGJ-IBGZPJMESA-N |
| XLogP | 4.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|