C18H16ClNO2 — CID 888553
(2S)-2-(4-chlorophenyl)-1-(3-methoxyphenyl)-3-methyl-2H-pyrrol-5-one (PubChem CID 888553) has the molecular formula C18H16ClNO2 and a molecular weight of 313.78 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-1-(3-methoxyphenyl)-3-methyl-2H-pyrrol-5-one.
| Compound Name | (2S)-2-(4-chlorophenyl)-1-(3-methoxyphenyl)-3-methyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 888553 |
| Molecular Formula | C18H16ClNO2 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-1-(3-methoxyphenyl)-3-methyl-2H-pyrrol-5-one |
| SMILES | COc1cccc(N2C(=O)C=C(C)[C@H]2c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H16ClNO2/c1-12-10-17(21)20(15-4-3-5-16(11-15)22-2)18(12)13-6-8-14(19)9-7-13/h3-11,18H,1-2H3/t18-/m0/s1 |
| InChIKey | MJNRUAAPPJEDQH-SFHVURJKSA-N |
| XLogP | 4.38 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |