C16H14Cl2N2O2 — CID 124503896
(3S,4S)-3-amino-4-(2,4-dichlorophenyl)-1-(3-methoxyphenyl)azetidin-2-one (PubChem CID 124503896) has the molecular formula C16H14Cl2N2O2 and a molecular weight of 337.21 g/mol. Its IUPAC name is (3S,4S)-3-amino-4-(2,4-dichlorophenyl)-1-(3-methoxyphenyl)azetidin-2-one.
| Compound Name | (3S,4S)-3-amino-4-(2,4-dichlorophenyl)-1-(3-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 124503896 |
| Molecular Formula | C16H14Cl2N2O2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (3S,4S)-3-amino-4-(2,4-dichlorophenyl)-1-(3-methoxyphenyl)azetidin-2-one |
| SMILES | COc1cccc(N2C(=O)[C@@H](N)[C@@H]2c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O2/c1-22-11-4-2-3-10(8-11)20-15(14(19)16(20)21)12-6-5-9(17)7-13(12)18/h2-8,14-15H,19H2,1H3/t14-,15-/m0/s1 |
| InChIKey | WCJYOGMQYJECQY-GJZGRUSLSA-N |
| XLogP | 3.42 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |