C11H14N2O2 — CID 124676535
(3R,4R)-3-amino-1-(3-methoxyphenyl)-4-methylazetidin-2-one (PubChem CID 124676535) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (3R,4R)-3-amino-1-(3-methoxyphenyl)-4-methylazetidin-2-one.
| Compound Name | (3R,4R)-3-amino-1-(3-methoxyphenyl)-4-methylazetidin-2-one |
|---|---|
| PubChem CID | 124676535 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3R,4R)-3-amino-1-(3-methoxyphenyl)-4-methylazetidin-2-one |
| SMILES | COc1cccc(N2C(=O)[C@H](N)[C@H]2C)c1 |
| InChI | InChI=1S/C11H14N2O2/c1-7-10(12)11(14)13(7)8-4-3-5-9(6-8)15-2/h3-7,10H,12H2,1-2H3/t7-,10-/m1/s1 |
| InChIKey | LXQOBNROMWLEPK-GMSGAONNSA-N |
| XLogP | 0.76 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |