C29H23NO5S — CID 5470277
(5E)-3-(2-methoxyphenyl)-1,1-dioxo-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 5470277) has the molecular formula C29H23NO5S and a molecular weight of 497.57 g/mol. Its IUPAC name is (5E)-3-(2-methoxyphenyl)-1,1-dioxo-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2-methoxyphenyl)-1,1-dioxo-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5470277 |
| Molecular Formula | C29H23NO5S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | (5E)-3-(2-methoxyphenyl)-1,1-dioxo-5-[(3-phenoxyphenyl)methylidene]-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | COc1ccccc1N1C(=O)/C(=C\c2cccc(Oc3ccccc3)c2)S(=O)(=O)C1c1ccccc1 |
| InChI | InChI=1S/C29H23NO5S/c1-34-26-18-9-8-17-25(26)30-28(31)27(36(32,33)29(30)22-12-4-2-5-13-22)20-21-11-10-16-24(19-21)35-23-14-6-3-7-15-23/h2-20,29H,1H3/b27-20+ |
| InChIKey | ILHVWGGZRITUMF-NHFJDJAPSA-N |
| XLogP | 5.99 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|