C52H48Cl2N4O10S5 — CID 10653794
bis(N-[(5R,6R)-6-(4-chlorophenyl)-2-ethylsulfanyl-3-(4-methoxyphenyl)-4-oxo-5,6-dihydro-1,3-thiazin-3-ium-5-yl]benzamide);sulfate (PubChem CID 10653794) has the molecular formula C52H48Cl2N4O10S5 and a molecular weight of 1120.21 g/mol. Its IUPAC name is bis(N-[(5R,6R)-6-(4-chlorophenyl)-2-ethylsulfanyl-3-(4-methoxyphenyl)-4-oxo-5,6-dihydro-1,3-thiazin-3-ium-5-yl]benzamide);sulfate.
| Compound Name | bis(N-[(5R,6R)-6-(4-chlorophenyl)-2-ethylsulfanyl-3-(4-methoxyphenyl)-4-oxo-5,6-dihydro-1,3-thiazin-3-ium-5-yl]benzamide);sulfate |
|---|---|
| PubChem CID | 10653794 |
| Molecular Formula | C52H48Cl2N4O10S5 |
| Molecular Weight | 1120.21 g/mol |
| Exact Mass | 1118.14 |
| IUPAC Name | bis(N-[(5R,6R)-6-(4-chlorophenyl)-2-ethylsulfanyl-3-(4-methoxyphenyl)-4-oxo-5,6-dihydro-1,3-thiazin-3-ium-5-yl]benzamide);sulfate |
| SMILES | CCSC1=[N+](c2ccc(OC)cc2)C(=O)[C@@H](NC(=O)c2ccccc2)[C@@H](c2ccc(Cl)cc2)S1.CCSC1=[N+](c2ccc(OC)cc2)C(=O)[C@@H](NC(=O)c2ccccc2)[C@@H](c2ccc(Cl)cc2)S1.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C26H23ClN2O3S2.H2O4S/c2*1-3-33-26-29(20-13-15-21(32-2)16-14-20)25(31)22(28-24(30)18-7-5-4-6-8-18)23(34-26)17-9-11-19(27)12-10-17;1-5(2,3)4/h2*4-16,22-23H,3H2,1-2H3;(H2,1,2,3,4)/t2*22-,23+;/m00./s1 |
| InChIKey | URFWJYOHQDAKPP-WOJNTMLLSA-N |
| XLogP | 10.49 |
| TPSA | 197.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1120.21 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|